On Target MIF_HUMAN 0.2682927/CHEMBL209588
For the given ligand Methadone, we have found in our database that, being scored 0.2682927, the most similar ligand is CHEMBL209588. Check out the elaboration below.
| Methadone (Given Ligand) | CHEMBL209588 (Similar Ligand) |
|---|---|
| CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C)(C)CC(=O)C[C@H]1CC(=NO1)c2ccc(O)c(F)c2 |
|
|
|
|
|
|
| 00030000 01000200 00100102 00010600 00000000 00000000 00000000 01000000 00000800 000808c0 08300000 40019000 05008000 00200000 40000000 00040000 00000000 02000000 00002000 00000001 00000100 18000210 00000000 00500010 00000000 a0000000 00000000 50000000 00000080 0006000a 00022000 00800600 | 00010000 01000008 20900102 02050a00 02080000 10440010 02000040 00002400 08108948 00092841 08110000 50009000 9400880a 00a01000 00000008 00090018 00000800 02000000 00406000 00860401 00000100 28018200 01001042 00400010 00000000 80020004 e0120000 02000001 0010400a 00028002 400a0000 00000600 |