On Target IKKB_HUMAN 0.3381295/CHEMBL3823257
For the given ligand Pethidine, we have found in our database that, being scored 0.3381295, the most similar ligand is CHEMBL3823257. Check out the elaboration below.
| Pethidine (Given Ligand) | CHEMBL3823257 (Similar Ligand) |
|---|---|
| CCOC(=O)C2(c1ccccc1)CCN(C)CC2 | COC(=O)C(=C)CC1(O)C(=O)Nc2ccccc12 |
|
|
|
|
|
|
| 00020000 01000200 00100100 00010700 00100040 00000000 00000000 20000040 00000800 000808c0 08300000 50019000 05008002 00000000 40040000 000c1008 08020000 02000000 04400000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000200 10000000 00000200 0006000a 00002000 00800e00 | 00054002 01000000 00101112 00010700 20280080 00006000 01000000 00000400 11000900 001a08c2 083800a4 4001d000 05008030 01300000 40020144 00080008 0086c000 02000000 18400018 00000001 40100100 18200e20 23002000 81500011 00000000 80000200 08000010 90001080 04008200 80060003 44002080 20410610 |