On Target CASP1_HUMAN 0.41326532/CHEMBL3898379
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.41326532, the most similar ligand is CHEMBL3898379. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL3898379 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | CC1Oc2c(C)c(C)c(O)c(C)c2CC1CN3CCN(CC3)c4cc(nc(n4)N5CCCC5)N6CCCC6 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04010002 43000219 2010012a 0c090700 22001009 c2006010 0200b800 20100a80 00000900 20080ac0 08300004 40009840 04800002 00202080 11020021 021c200c 00241000 2200c000 00c80000 00a20201 00100100 3e040000 218048e1 02400412 00080001 c0100001 00080400 100000c0 08000318 0046c80a 40001000 020006c0 |