Created at: Last updated at: Current status:
|
Name | Dihydrocodeine |
2D and 3D depictions | |
SMILES | COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C |
Model downloads | |
Fingerprints |
Name | Oxycodone |
2D and 3D depictions | |
SMILES | COc2ccc1C[C@H]4N(C)CC[C@]35c1c2O[C@H]3C(=O)CC[C@@]45O |
Model downloads | |
Fingerprints |
Name | Diclofenac |
2D and 3D depictions | |
SMILES | O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
Model downloads | |
Fingerprints |
Name | Codeine |
2D and 3D depictions | |
SMILES | COc1ccc2C[C@@H]5[C@@H]3/C=C\[C@H](O)[C@@H]4Oc1c2[C@]34CCN5C |
Model downloads | |
Fingerprints |
Name | Morphine |
2D and 3D depictions | |
SMILES | CN4CC[C@]23c1c5ccc(O)c1O[C@H]2[C@@H](O)/C=C\[C@H]3[C@H]4C5 |
Model downloads | |
Fingerprints |