On Target PDE4B_HUMAN 0.5890411/CHEMBL144499
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.5890411, the most similar ligand is CHEMBL144499. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL144499 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | COc1ccc(cc1OC2CCCC2)[C@H]3CCN4[C@@H]3CCC4=O |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04030000 43001208 2010010a 00210700 00081000 c2000010 02040000 20000004 00000880 000808c0 08300000 40019000 0480c00a 20200080 11000001 020ca008 00800000 02000000 00482000 00020201 00000100 18240610 01000000 81500018 00000000 80000000 00120000 10000000 04000202 0106000b 00020000 00802640 |