On Target 5HT1B_HUMAN 0.6766917/CHEMBL29951
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.6766917, the most similar ligand is CHEMBL29951. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL29951 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | CCCN(CCC)C1CCc2cccc(OCCCCCCOc3cccc4CCC(Cc34)N(CCC)CCC)c2C1 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04000000 43000208 2010010a 00010700 00081020 c2000000 02000000 20000201 00000880 000808c0 08300000 408080c0 00800002 20a00080 11000001 020c2008 90800200 22008000 00482000 00020201 00000100 18200000 01004000 81400410 00000000 c0000001 00000000 10000000 04000302 0006400a 00000000 00002600 |