On Target 5HT2B_HUMAN 0.64/CHEMBL445106
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.64, the most similar ligand is CHEMBL445106. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL445106 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | COc1cc(Br)c2OC[C@H]3C[C@@H](N)Cc1c23 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04005000 53008208 2000050a 01010700 00181061 c2000002 02000000 00000241 40000800 000818c0 08100002 c08080c0 00800012 20a00081 11040001 02082018 18800200 02000400 04482000 00024201 00000100 18000000 01004000 91400410 00000000 c0000001 001a0200 00000000 06800302 0006c80a 00000008 0a000400 |