On Target PDE5A_HUMAN 0.06918239/CHEMBL484065
For the given ligand Metformin, we have found in our database that, being scored 0.06918239, the most similar ligand is CHEMBL484065. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL484065 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CCN1C(=O)C2C(N=CN2Cc3ccc(O)c(Br)c3)N4[C@H]5CCC[C@H]5N=C14 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 0000c040 23008408 20100140 84010e00 22000020 00080000 22c30044 22003000 40000640 00030df2 12202030 c001b000 0b00bc12 00012009 00001500 00310088 10010818 02000000 00100050 00020201 00312100 3a038620 00008013 02500218 10013090 c0000000 40630000 90001000 0a000110 01060011 801c4109 08012200 |