Created at: Last updated at: Current status:
|
Name | Omeprazole |
2D and 3D depictions |
|
SMILES | COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 |
Model downloads | |
Fingerprints |
Name | Metolazone |
2D and 3D depictions |
|
SMILES | Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C |
Model downloads | |
Fingerprints |
Name | Metformin |
2D and 3D depictions |
|
SMILES | CN(C)C(=N)NC(=N)N |
Model downloads | |
Fingerprints |
Name | Oseltamivir |
2D and 3D depictions |
|
SMILES | CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 |
Model downloads | |
Fingerprints |
Name | Miglitol |
2D and 3D depictions |
|
SMILES | OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
Model downloads | |
Fingerprints |