On Target FABP5_HUMAN 0.22916667/CHEMBL82293
For the given ligand Miglitol, we have found in our database that, being scored 0.22916667, the most similar ligand is CHEMBL82293. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL82293 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CCCCCCCCCCCCCCCC(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00010000 01000000 00000000 00000000 00080000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00800000 00000000 00080008 00000000 00000000 00402000 00000001 00000000 00000a00 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 |