On Target MK01_HUMAN 0.05882353/CHEMBL1975647
For the given ligand Metformin, we have found in our database that, being scored 0.05882353, the most similar ligand is CHEMBL1975647. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL1975647 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | Fc1cccc2c(NC(=O)Nc3cnccn3)ccnc12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000006 00000000 00184000 06000a60 01040040 08000010 00008000 00002001 00000000 40000840 00380024 40108000 00008800 00701000 00820042 00140004 08040000 00006000 88200000 00a00000 40000100 48048408 21826800 80000020 01100002 00000100 00008400 10000089 00008018 00469001 00040800 000043c0 |