On Target AOFA_HUMAN 0.25/CHEMBL2426048
For the given ligand Miglitol, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL2426048. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL2426048 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | OC(CNCC#C)COc1ccc(cc1)c2ccccc2 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 04002000 00000008 20100108 00010600 00403080 02000000 02040000 00100800 00000000 00000840 00200000 40008000 00800012 00000000 01300001 00082008 10220000 02000000 04800000 00020200 00000000 18000000 17010080 08400010 00000001 80000000 00020000 00800040 00004200 00060000 00000020 00000240 |