On Target PPARG_HUMAN 0.06349207/CHEMBL2336643
For the given ligand Metformin, we have found in our database that, being scored 0.06349207, the most similar ligand is CHEMBL2336643. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL2336643 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CCOC(CNCc1ccc(cc1)C(F)(F)F)OCC |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000008 00000000 00100100 80010600 00000080 00000000 00000400 0a001000 00200100 00000870 00200000 40008000 80000802 01000000 00001408 00280008 10000000 02000000 00000000 00000000 00000000 08008000 12000000 00400000 00000400 c0000000 00000100 b4000001 00000300 00060000 00140000 00000200 |