On Target PPARG_HUMAN 0.33783785/CHEMBL1836976
For the given ligand Miglitol, we have found in our database that, being scored 0.33783785, the most similar ligand is CHEMBL1836976. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL1836976 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | C[C@]12CC[C@@](C)(C[C@H]1C3=CC(=O)[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC2)C(=O)NCCN |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00010000 01002000 00100000 00000400 00080000 00000000 00000080 20000402 01000000 00108080 00200000 40011000 0402800a 00800000 00000400 00080008 00000000 00000020 02412000 00000201 00000000 30000690 01008001 02100018 00200000 00000000 00404000 90000000 08000000 00040001 24020000 00000200 |