On Target PDE4B_HUMAN 0.06/CHEMBL284970
For the given ligand Metformin, we have found in our database that, being scored 0.06, the most similar ligand is CHEMBL284970. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL284970 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | COc1ccc(cc1OC2CCCC2)C3CCN(C3)C(=N)S |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 04000000 43000208 20104108 00310700 00081000 c2000010 02040000 00000000 00000a80 000808c2 88300000 40008000 00806002 20080080 11000001 021ca008 00808010 02000200 00480000 00020201 00000100 18200000 01000000 81400010 00000000 80000000 40120000 10000000 04000210 0106000a 80000000 00010640 |