On Target PDE4B_HUMAN 0.20454545/CHEMBL144823
For the given ligand Miglitol, we have found in our database that, being scored 0.20454545, the most similar ligand is CHEMBL144823. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL144823 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | COc1ccc(cc1OC2CCCC2)[C@H]3CCN4[C@@H]3COC4=O |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 04000000 43405208 20100308 00210700 00081080 c2008010 02040000 a0000004 00400a80 000808c0 08300000 40018000 0080c002 21000180 11081001 021ea008 10860000 02080000 00480800 00020201 00000100 18240c50 13000040 81500018 00000000 80001002 10120000 10200001 04000200 0106000b 80000000 00000640 |