On Target ACM4_HUMAN 0.44354838/CHEMBL313738
For the given ligand Oseltamivir, we have found in our database that, being scored 0.44354838, the most similar ligand is CHEMBL313738. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL313738 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CN1C2CCCC1C(C2)OC(=O)C3CCCCC3 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00010040 01000000 00100300 80010700 00080080 00000010 00000000 20000000 00000000 00000080 00200000 50019000 0400800a 00880000 00081008 00081008 10a60000 00000000 02c02000 00000201 00000020 10000a10 13000080 00100010 10000401 00000000 00000000 10001001 00000200 00040006 00020000 00002200 |