On Target TNFA_HUMAN 0.05645161/CHEMBL1595790
For the given ligand Metformin, we have found in our database that, being scored 0.05645161, the most similar ligand is CHEMBL1595790. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL1595790 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | Cc1ccc2oc(N=C(N)NC(=O)C(C)(C)C)nc2c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000042 00000800 001a2100 00810e00 00040304 00000040 00000400 00022200 80084221 20040852 10200024 4000b040 40009400 01600008 04000040 1054000c 00000800 c2000000 002000c0 44200000 40012000 1e010600 20c28800 24780010 00000000 80008008 40c00950 18080000 00002018 01064001 00140000 00000230 |