On Target NEP_HUMAN 0.06870229/CHEMBL3695450
For the given ligand Metformin, we have found in our database that, being scored 0.06870229, the most similar ligand is CHEMBL3695450. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL3695450 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | C[C@H](N[C@@H](Cc1ccc(cc1)c2ccccc2)C(=O)NC3=NNNN3)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 0080200c 00800240 00100100 14010e00 00000080 00000200 00000000 03003000 00000f82 200808c2 08302008 4000b803 0600b002 00002003 80180000 001c001c 10030010 02000000 04001c08 10c02203 00010100 38210e00 d3002000 83400010 00000800 80001000 40800000 10000040 0c004038 008e000b 80084000 00000700 |