On Target NEP_HUMAN 0.26339287/CHEMBL305388
For the given ligand Omeprazole, we have found in our database that, being scored 0.26339287, the most similar ligand is CHEMBL305388. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL305388 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | COc1ccc2[C@@H](CCc2c1)[C@@H](CS)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)O |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00010002 43005e08 2010010a 41910610 00041080 40000002 03042000 20000005 00600880 000908c0 08300004 4003b000 1e00880a 20641800 81080041 020e000c 10000000 02000000 00682408 00420201 60000100 18208e18 23804340 91500018 00043801 80000001 08120000 10000000 04000202 0006003b 20044200 01012620 |