On Target ALDR_HUMAN 0.45945945/CHEMBL291854
For the given ligand Metolazone, we have found in our database that, being scored 0.45945945, the most similar ligand is CHEMBL291854. Check out the elaboration below.
| Metolazone (Given Ligand) | CHEMBL291854 (Similar Ligand) |
|---|---|
| Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C | CN1C(=O)Nc2cc(Cl)ccc2C13NC(=O)NC3=O |
|
|
|
|
|
|
| 1000c016 00802801 01004100 03b10e40 00020130 40110042 08000004 02003009 01800000 20084840 01282004 6000c800 02008846 00100001 802204c0 00000100 00044000 03400022 08010000 00806801 c0100100 08038700 20032000 0844001c 00102000 c0080000 00040010 800010c8 00008100 20060001 80040000 c0034221 | 00018006 03803000 00100100 02010e00 00000000 40100002 08000004 0200300d 00000000 000a0840 0d280066 4000b800 0700b864 00102001 40020140 00000000 0004c018 03402024 08000010 008040c1 c0020500 38238700 20022000 81400018 00103000 80000200 00040010 80001080 0c009100 00060a03 20046001 e0024600 |