On Target AA1R_HUMAN 0.06481481/CHEMBL329774
For the given ligand Metformin, we have found in our database that, being scored 0.06481481, the most similar ligand is CHEMBL329774. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL329774 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CCCN1C(=O)C2NC(NC2N(CCCOC(=O)CBr)C1=O)C3CCCC3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00010000 0300b400 00100100 04010e00 00000000 00000000 00000024 20002008 00000000 000201a0 06200002 4001b000 0f00b102 00082000 80000000 00080008 00220010 00802001 00802050 00000201 00020920 301b0e10 01000081 02100018 00013403 00000000 00000000 10000100 08000200 01040015 08184009 00002200 |