On Target AOFB_HUMAN 0.30769232/CHEMBL2332210
For the given ligand Miglitol, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL2332210. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL2332210 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CC(C)C[C@@H](CF)N(C)CC#C |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00000000 01000000 00100000 00000400 00402000 00000000 00000000 20100000 00000000 80000080 00200000 40000000 00000002 00400000 00100000 00000000 00000000 00000000 00000000 00000201 00000000 10000000 00010000 00300010 00000000 00000000 00000020 10000000 00000000 02040000 00000022 00000200 |