On Target PGH1_SHEEP 0.103174604/CHEMBL15904
For the given ligand Metformin, we have found in our database that, being scored 0.103174604, the most similar ligand is CHEMBL15904. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL15904 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CN1C(=NC(=O)/C/1=C/c2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)NC(=N)N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00410208 00010008 20800100 10010e00 00000001 0008000c 828200a4 40002600 01802440 001a0c62 1a200210 4000a003 0400a002 00000008 00000002 80382008 20000c00 12004100 10018004 10820000 00200100 28030600 00000001 00401810 00000080 80000000 40423009 60850100 0a404010 00268002 04004141 10010600 |