On Target NMDE2_HUMAN 0.10344828/CHEMBL348360
For the given ligand Metformin, we have found in our database that, being scored 0.10344828, the most similar ligand is CHEMBL348360. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL348360 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | FC(F)(F)c1ccc(cc1)C(=N)NCc2cccc(c2)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000000 00020000 00100100 00010600 00000001 00000000 10000400 02001000 00000100 00000853 00200000 40008802 80000802 01000000 00000400 00180008 00002000 02000000 00000000 00000000 00000000 08008000 00000000 00400000 00000000 c0000000 48000100 90000000 00000118 00060000 40140000 00000200 |