On Target NMDE2_HUMAN 0.35897437/CHEMBL17350
For the given ligand Miglitol, we have found in our database that, being scored 0.35897437, the most similar ligand is CHEMBL17350. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL17350 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | C[C@@H]([C@@H](O)c1ccc(O)cc1)N2CCC(O)(CC2)c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00000000 01000208 20100100 00010600 00000080 00004000 02000000 20000000 00000980 000808c0 08300000 50018000 00000002 00000000 00080000 000c0008 10000000 02000000 00800000 00020201 00000100 18200020 03000080 81500010 00000001 80000000 00520000 10000000 04000000 0006000a 40000000 00002600 |