On Target P2RX3_HUMAN 0.0625/CHEMBL3895492
For the given ligand Metformin, we have found in our database that, being scored 0.0625, the most similar ligand is CHEMBL3895492. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL3895492 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CCC1C(=O)N\C(=N/c2ccc(OC(C)C)cc2)\N(Cc3ccc(Cl)cc3)C1=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 04008042 01800408 20100108 00010e00 00001000 00000000 02000004 22003008 00000300 800209f2 11200004 44009820 0f809846 40000008 010004c1 00180008 00004800 02000000 01000050 00020201 c0012100 1a018700 22000010 00400018 00093000 c8000000 40440000 90000800 00000310 00860211 a00c0000 80020200 |