On Target 5HT2A_HUMAN 0.3419355/CHEMBL343529
For the given ligand Omeprazole, we have found in our database that, being scored 0.3419355, the most similar ligand is CHEMBL343529. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL343529 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | COc1cccc2[nH]cc(CCN)c12 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00000002 42000808 20000108 41010610 00041000 80000000 06082000 00000008 00400000 00090840 08000004 40008000 10000806 20400000 01000041 0004000c 00000000 02000004 00280400 00060000 40000000 18008008 20800000 81400010 00042000 80000000 08000000 00000000 04000200 00060002 00040200 00200420 |