On Target AGTR2_HUMAN 0.3469388/CHEMBL263452
For the given ligand Metolazone, we have found in our database that, being scored 0.3469388, the most similar ligand is CHEMBL263452. Check out the elaboration below.
| Metolazone (Given Ligand) | CHEMBL263452 (Similar Ligand) |
|---|---|
| Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C | CCC1=Nc2ccc(NC(=O)N(C)C(C)C)cc2C(=O)N1Cc3ccc(cc3F)c4ccccc4S(=O)(=O)NC(=O)c5ccc(CC)cc5 |
|
|
|
|
|
|
| 1000c016 00802801 01004100 03b10e40 00020130 40110042 08000004 02003009 01800000 20084840 01282004 6000c800 02008846 00100001 802204c0 00000100 00044000 03400022 08010000 00806801 c0100100 08038700 20032000 0844001c 00102000 c0080000 00040010 800010c8 00008100 20060001 80040000 c0034221 | 0000201e 00800a01 01180100 53b10e00 000c0020 00004038 04001805 00803001 86100108 500838e0 0938a00c 70818800 800b9800 00f01001 803200c0 020c0004 02062280 0250c008 0c680000 10016004 c0000100 18038638 3182a041 8970041c 02102004 c0000084 e0000000 000400cd 0400c404 2046804b c02c5000 600147e0 |