On Target OPRM_MOUSE 0.060240965/CHEMBL2368132
For the given ligand Metformin, we have found in our database that, being scored 0.060240965, the most similar ligand is CHEMBL2368132. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL2368132 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | C[C@H]1C2Cc3ccc(O)cc3[C@@]1(C)CCN2CCCC#N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000000 43000208 20100102 00010e00 00000020 40000002 02000000 20002001 00000880 000808c0 08300000 50818000 00000002 00200000 00000020 02040008 00400200 02000000 00002000 00020201 00000100 18200010 00004400 81500010 00000000 80000001 00120000 10000000 04000002 0006000a 00020000 00002680 |