On Target OPRM_MOUSE 0.32673267/CHEMBL185687
For the given ligand Metolazone, we have found in our database that, being scored 0.32673267, the most similar ligand is CHEMBL185687. Check out the elaboration below.
| Metolazone (Given Ligand) | CHEMBL185687 (Similar Ligand) |
|---|---|
| Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C | CCNC(=O)c1ccc(cc1)C(=C2CC3CCC(C2)N3Cc4ccccn4)c5cccc(NC(=O)C)c5 |
|
|
|
|
|
|
| 1000c016 00802801 01004100 03b10e40 00020130 40110042 08000004 02003009 01800000 20084840 01282004 6000c800 02008846 00100001 802204c0 00000100 00044000 03400022 08010000 00806801 c0100100 08038700 20032000 0844001c 00102000 c0080000 00040010 800010c8 00008100 20060001 80040000 c0034221 | 08004002 09000800 40104300 50010e00 04040024 00100010 80080080 23003401 00400100 001808d8 08290004 50018800 80028802 00100000 00020442 02040104 00040400 02000042 08202000 00000203 45100000 18038610 2080a020 0050001c 01140000 e0000000 00406040 d0001080 00408184 00060c03 a4060000 00006600 |