On Target NOS2_HUMAN 0.3015873/CHEMBL195352
For the given ligand Oseltamivir, we have found in our database that, being scored 0.3015873, the most similar ligand is CHEMBL195352. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL195352 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CC1(C)CC[C@@]2(CC[C@]3(C)C(=CCC4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)C5CC[C@@]34C)C2C1)C(=O)O |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00010000 81000000 00000000 00000420 00080000 00080000 00000080 00000402 01000000 00108000 00000000 40001000 04028008 00800000 00000401 00080008 00400000 00000020 02412000 02002001 00000000 10000a80 01008400 00000010 00200002 00000000 00404200 80000000 00080000 80040000 24020000 00000080 |