On Target SCN9A_HUMAN 0.2970297/CHEMBL3632696
For the given ligand Miglitol, we have found in our database that, being scored 0.2970297, the most similar ligand is CHEMBL3632696. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL3632696 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | OC(COc1ccc(cc1)C(F)(F)F)CN2CCC(CC2)NC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 04000000 01001c08 20100108 00010600 00001080 02000000 02040400 22001000 00000000 000009f0 00200000 50018000 00808802 01000000 01280401 00082008 10200000 02000000 00800000 00020201 00000000 180a8600 07000080 0850001c 00000001 c0000000 00020400 90800000 00000300 00060011 a0140000 00002240 |