On Target AA2AR_HUMAN 0.2651515/CHEMBL3770601
For the given ligand Miglitol, we have found in our database that, being scored 0.2651515, the most similar ligand is CHEMBL3770601. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL3770601 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CCNC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)ncnc23 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 0000000a 01c01800 80180000 88090620 001800e0 0000c000 00008c00 20000800 00400100 018000b0 0c20800c 40019004 00001002 01880300 00081088 101fc00c 10200020 00000000 19c00000 80201201 80080020 10000070 378000c0 0c100014 10000401 40080002 00000200 10000071 00000209 00460000 c0280000 00000ac0 |