On Target CXCR1_HUMAN 0.14917128/CHEMBL556862
For the given ligand Miglitol, we have found in our database that, being scored 0.14917128, the most similar ligand is CHEMBL556862. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL556862 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CC[C@@H](NC1=C(Nc2cccc(C(=O)N3CCCC3C(=O)O)c2O)C(=O)C1=O)c4ccccc4 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 1041c00a 01005808 60100102 00012600 20090081 68022010 020000a0 22401500 05a00c40 001808d0 08380004 5043b000 0e008812 01200000 800a0440 10086048 10050001 22008000 08630210 20020201 48100980 18168e00 23000000 0050801c 04041000 c0000080 20400010 900c0580 20508102 20060003 a4045420 40002600 |