On Target TRY1_HUMAN 0.10526316/CHEMBL149324
For the given ligand Metformin, we have found in our database that, being scored 0.10526316, the most similar ligand is CHEMBL149324. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL149324 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | NC(=N)Nc1ccc(cc1)C(=O)Oc2ccccc2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 04000002 00000818 20000108 80090a00 00001000 00004000 02000000 00002001 00000100 00000842 00200004 40008000 00808002 00018000 01010041 02080008 00060000 02000000 08000000 00020000 40020000 08020a20 30000000 00c01004 00100000 80002000 40000000 00000080 00008210 00060000 c0000000 14004000 |