On Target 5HT1B_HUMAN 0.28125/CHEMBL136470
For the given ligand Miglitol, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL136470. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL136470 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CN(C)CCCCOc1cccc2ccccc12 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 04000000 00000008 20100008 00010700 00101000 02000000 02000000 00000000 00000000 000008c0 00200000 40008000 00800002 00000000 11000001 00082008 00000000 00000000 00400000 00020001 00000000 18000008 01000000 00000010 00000000 00000000 00000200 10000000 00000200 00060000 00000000 00000a00 |