On Target CXCR4_HUMAN 0.12307692/CHEMBL2347630
For the given ligand Metformin, we have found in our database that, being scored 0.12307692, the most similar ligand is CHEMBL2347630. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL2347630 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | N=C(NCCCNCCCCNCCCNC(=N)Nc1cccc2ccccc12)Nc3cccc4ccccc34 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00000006 00000410 00100000 00000e00 00000000 00000000 00000004 20002001 00200200 000009e2 00200004 40028000 00001002 00000000 00000040 00100000 00040000 00400000 08000000 00000201 40020100 18010008 20020000 00000010 00110000 00000000 40000000 10000080 00008010 00060011 00100000 04006200 |