On Target MTOR_HUMAN 0.30952382/CHEMBL3972399
For the given ligand Miglitol, we have found in our database that, being scored 0.30952382, the most similar ligand is CHEMBL3972399. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL3972399 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CCCNC(=O)CC[C@@]1(C)[C@@H](CC[C@]2(C)[C@@H]1C[C@@H](F)C34OC(=O)[C@@]5(CC[C@@H](C)[C@H](C)[C@@H]35)CC[C@@]24C)C(=C)C |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00050040 01001000 00100100 00010700 00081400 00000000 00000004 20000400 00000000 00100080 00240000 40019000 0400800a 00800000 00080400 00081008 00820000 00400000 02402000 00000201 00000120 10000e10 01000000 00500018 00000400 00000000 00000020 90000000 00000200 02040003 24020000 00002600 |