On Target FYN_HUMAN 0.31617647/CHEMBL407135
For the given ligand Oseltamivir, we have found in our database that, being scored 0.31617647, the most similar ligand is CHEMBL407135. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL407135 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CCC(C)CCCC(=O)N[C@@H](CCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@@H](NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O)[C@H](C)O |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00030000 01007400 00100000 04000400 00000080 00000000 00000000 20000008 00200000 000001a0 00200000 40033000 1600800a 00002001 80180000 00080008 10000000 00000000 00802000 00000201 00000000 300c0610 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040011 20024000 00802200 |