On Target ESR1_HUMAN 0.109375/CHEMBL3597502
For the given ligand Metformin, we have found in our database that, being scored 0.109375, the most similar ligand is CHEMBL3597502. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL3597502 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CC[C@H](C)[C@H](NC(=O)C(CC)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)NC(CC)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NC(CC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00010000 01003000 00100000 04000c00 00000000 00000000 00000000 20002008 00200200 00000082 00200000 40033000 06009012 00002001 80000000 00100000 00000000 00000000 00000000 00000201 00000000 30050620 00000003 02100018 00000000 00000000 40000000 10000000 08000010 00040001 a0084000 00002200 |