On Target ESR1_HUMAN 0.29591838/CHEMBL3586194
For the given ligand Miglitol, we have found in our database that, being scored 0.29591838, the most similar ligand is CHEMBL3586194. Check out the elaboration below.
| Miglitol (Given Ligand) | CHEMBL3586194 (Similar Ligand) |
|---|---|
| OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO | CC\C(=C(/c1ccc(O)cc1)\c2ccc(OCCNCCCCCCCCCCO)cc2)\c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00100010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 04002000 01000008 20100308 00010602 00081080 00000000 82040080 21000400 00000800 001808c0 08300100 40018000 00800002 00800000 01081003 00080008 10000400 02000000 00402000 00020201 00000100 18040010 13008001 00500010 01000000 a0000000 00522000 50000001 00400280 00060002 04020000 00000600 |