On Target NMDZ1_HUMAN 0.27567568/CHEMBL401253
For the given ligand Aceclofenac, we have found in our database that, being scored 0.27567568, the most similar ligand is CHEMBL401253. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL401253 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CCc1c(Cl)cc2NC(=O)C(=O)Nc2c1N(CCO)S(=O)(=O)C |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 0001c022 0000c804 00001906 41310620 000c00c0 08000040 08008006 00401100 06040000 00080860 0c202004 40008800 82008c0c 00400001 809e0041 000e000c 0c068000 02000404 08200000 01004000 40140481 18848900 23800000 40600850 82006082 c0100200 180084c0 000210bc 04488000 00460002 00040000 204326e0 |