Created at: Last updated at: Current status:
|
Name | Sulfasalazine |
2D and 3D depictions | |
SMILES | O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O |
Model downloads | |
Fingerprints |
Name | Aceclofenac |
2D and 3D depictions | |
SMILES | O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
Model downloads | |
Fingerprints |
Name | Alclofenac |
2D and 3D depictions | |
SMILES | C=CCOc1ccc(CC(=O)O)cc1Cl |
Model downloads | |
Fingerprints |
Name | Curcumin |
2D and 3D depictions | |
SMILES | COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O |
Model downloads | |
Fingerprints |
Name | Fentanyl |
2D and 3D depictions | |
SMILES | CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 |
Model downloads | |
Fingerprints |