On Target PERM_HUMAN 0.28125/CHEMBL3741401
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL3741401. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL3741401 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | Cc1ccc(cc1)S(=O)(=O)NN2C(=S)Nc3ccc(F)cc3C2=O |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00080012 00801000 01100100 42b10608 00140008 0000c030 02000000 00000a00 160c4120 400c0862 01002004 70008000 40008400 40601041 80200c48 000c8005 00002400 03008000 00600070 0001a000 d0002000 08010028 22900040 08500008 00000100 88010008 20000000 00040029 00006000 204b8000 40040002 000102a8 |