On Target ACES_HUMAN 0.37623763/CHEMBL158242
For the given ligand Alclofenac, we have found in our database that, being scored 0.37623763, the most similar ligand is CHEMBL158242. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL158242 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CCOc1cc2CC(C)C(=O)c2cc1OCC |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04000000 43000808 2000010b 00210200 00001000 40008000 02040000 00000000 00000800 00080840 08100000 40009000 0480c002 20201080 01004001 220a8008 00000000 02000000 00080008 00020201 00400100 08020240 00004000 00400014 00000800 80000001 00120000 00000000 00000200 0002000a 80000000 00000400 |