On Target PDE5A_HUMAN 0.3318584/CHEMBL79579
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.3318584, the most similar ligand is CHEMBL79579. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL79579 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CCCOc1ccc(cc1c2nc(O)c3c[nH]c4nncc4c3n2)S(=O)(=O)N5CC[C@H](C5)N(C)C |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 04014092 00804018 61104108 1db10600 000c1120 02014014 06021010 00280800 00000100 104209e0 8120a004 60018000 00800886 00802001 81e200c1 020ca10c 0000a000 2280a00c 00600800 00667403 c0020102 3c008060 a1800842 ba600038 02002400 8020000c 20820800 0000188c 08000704 20460410 41000802 082502f0 |