On Target PDE5A_HUMAN 0.29608938/CHEMBL158374
For the given ligand Curcumin, we have found in our database that, being scored 0.29608938, the most similar ligand is CHEMBL158374. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL158374 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | Oc1c2CN(C(c3ccc4OCOc4c3)c2nc5ccccc15)C(=O)\C=C\c6ccccc6 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 1000000a 47808008 20004108 10010e10 00041020 00180000 82144480 03003401 01a00000 00580840 49218004 40808000 0000c882 20610000 010206c3 0224a18c 20022400 02000107 10298000 00860a01 c0060200 08008e08 20804000 80468018 40140000 e0200000 087a6240 e0010000 03400384 00060003 04040000 a0254600 |