On Target TRPV1_RAT 0.44554454/CHEMBL294199
For the given ligand Curcumin, we have found in our database that, being scored 0.44554454, the most similar ligand is CHEMBL294199. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL294199 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1cc(CNC(=O)CCCC\C=C\C(C)C)ccc1O |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00010000 45800008 20100108 00010600 00001000 00000000 02000000 22001402 00000000 001008c0 00200000 40019000 0402c80a 00000000 01000401 00008008 00000000 02000000 00082000 00020201 80000000 18008610 00008000 00548018 00200000 c0000000 00624000 90000000 00000300 00060001 24040000 00000200 |