On Target TRPV1_RAT 0.5346535/CHEMBL2057854
For the given ligand Alclofenac, we have found in our database that, being scored 0.5346535, the most similar ligand is CHEMBL2057854. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL2057854 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CC(C(=O)NCc1ccc(cc1)C(C)(C)C)c2ccc(OCCN)c(Cl)c2 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04008000 04800008 20100108 00410602 00001000 00000000 06040000 02001000 00000180 00080840 08200000 40009800 83808806 00000000 c1001401 00080008 00000000 02000000 01000000 00020201 80000000 18248700 02000000 81480018 00002000 c0008800 00120000 80000000 04000300 00060003 20042000 00020600 |